CymitQuimica logo

CAS 1311166-10-5

:

Cyclobutanecarboxylic acid, 3-hydroxy-, t-butyl ester

Description:
Cyclobutanecarboxylic acid, 3-hydroxy-, t-butyl ester is an organic compound characterized by its ester functional group derived from cyclobutanecarboxylic acid and t-butanol. This compound features a cyclobutane ring, which is a four-membered carbon ring, contributing to its unique structural properties. The presence of a hydroxyl group at the 3-position of the cyclobutane ring enhances its reactivity and solubility in polar solvents. As an ester, it typically exhibits lower boiling points compared to the corresponding acids due to the absence of hydrogen bonding between molecules. The t-butyl group provides steric hindrance, which can influence the compound's reactivity and stability. This compound may be of interest in various applications, including organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c1-9(2,3)12-8(11)6-4-7(10)5-6/h6-7,10H,4-5H2,1-3H3
InChI key:TYVLAZGEMLWPQS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1CC(C1)O
Found 4 products.