CymitQuimica logo

CAS 1311197-79-1

:

5-Bromo-3-cyclopropyl-1-methyl-1H-indazole

Description:
5-Bromo-3-cyclopropyl-1-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a cyclopropyl group at the 3-position contributes to its unique reactivity and potential biological activity. The methyl group at the 1-position further modifies its electronic properties. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could be explored in various therapeutic contexts. Additionally, the presence of halogen and cyclic groups often influences solubility, stability, and lipophilicity, which are critical factors in drug design. As with many indazole derivatives, it may also be investigated for its role in various chemical reactions or as a building block in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C11H11BrN2
InChI:InChI=1S/C11H11BrN2/c1-14-10-5-4-8(12)6-9(10)11(13-14)7-2-3-7/h4-7H,2-3H2,1H3
InChI key:InChIKey=KJFYYJFGROXETI-UHFFFAOYSA-N
SMILES:CN1N=C(C=2C1=CC=C(Br)C2)C3CC3
Synonyms:
  • 5-Bromo-3-cyclopropyl-1-methyl-1H-indazole
  • 1H-Indazole, 5-bromo-3-cyclopropyl-1-methyl-
  • 5-Bromo-3-cyclopropyl-1-methylindazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.