CymitQuimica logo

CAS 1311197-82-6

:

5-Iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole

Description:
5-Iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a tetrahydro-2H-pyran moiety. The presence of an iodine atom at the 5-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The tetrahydro-2H-pyran group enhances the compound's solubility and may influence its biological activity. This compound is typically synthesized through multi-step organic reactions, often involving halogenation and cyclization processes. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both heterocyclic and alicyclic components. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the functional groups and overall molecular architecture. As with many halogenated compounds, safety and handling precautions are essential due to the potential for toxicity and environmental impact.
Formula:C8H11IN2O
InChI:InChI=1S/C8H11IN2O/c9-7-4-5-10-11(7)8-3-1-2-6-12-8/h4-5,8H,1-3,6H2
InChI key:InChIKey=FMLVAXQYSRRRBO-UHFFFAOYSA-N
SMILES:IC=1N(N=CC1)C2CCCCO2
Synonyms:
  • 1H-Pyrazole, 5-iodo-1-(tetrahydro-2H-pyran-2-yl)-
  • 5-Iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole
Found 4 products.