CAS 1311197-83-7
:4-Bromo-2-nitro-5-propoxy-N-propylbenzenamine
Description:
4-Bromo-2-nitro-5-propoxy-N-propylbenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a nitro group, and a propoxy group attached to a benzene ring, along with a propylamine substituent. This compound features a benzene core, which contributes to its aromatic properties, and the presence of the nitro group typically imparts electron-withdrawing characteristics, influencing its reactivity and solubility. The bromine atom can serve as a site for further substitution reactions, while the propoxy group enhances its hydrophobic nature, potentially affecting its solubility in organic solvents. The amine functional group suggests basicity and potential for hydrogen bonding, which may influence its interactions in biological systems or with other chemical species. Overall, the combination of these functional groups suggests that 4-Bromo-2-nitro-5-propoxy-N-propylbenzenamine may exhibit unique chemical reactivity and potential applications in fields such as pharmaceuticals or materials science.
Formula:C12H17BrN2O3
InChI:InChI=1S/C12H17BrN2O3/c1-3-5-14-10-8-12(18-6-4-2)9(13)7-11(10)15(16)17/h7-8,14H,3-6H2,1-2H3
InChI key:InChIKey=NOBNVOVIEYJIJT-UHFFFAOYSA-N
SMILES:N(CCC)C1=C(N(=O)=O)C=C(Br)C(OCCC)=C1
Synonyms:- Benzenamine, 4-bromo-2-nitro-5-propoxy-N-propyl-
- 4-Bromo-2-nitro-5-propoxy-N-propylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
