CymitQuimica logo

CAS 1311197-85-9

:

2,2′-Oxybis[5-bromobenzoic acid]

Description:
2,2′-Oxybis[5-bromobenzoic acid] is an organic compound characterized by its structure, which features two 5-bromobenzoic acid moieties linked by an ether (oxy) group. This compound is notable for its bromine substituents, which enhance its reactivity and potential applications in various chemical reactions, including electrophilic aromatic substitution. The presence of the carboxylic acid functional groups contributes to its acidity and solubility in polar solvents, making it useful in organic synthesis and materials science. Additionally, the compound may exhibit interesting properties such as potential antimicrobial activity or utility in the development of polymers and dyes. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its physical properties and reactivity. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential, particularly in terms of persistence and bioaccumulation. Overall, 2,2′-Oxybis[5-bromobenzoic acid] represents a versatile building block in organic chemistry with potential applications across multiple fields.
Formula:C14H8Br2O5
InChI:InChI=1S/C14H8Br2O5/c15-7-1-3-11(9(5-7)13(17)18)21-12-4-2-8(16)6-10(12)14(19)20/h1-6H,(H,17,18)(H,19,20)
InChI key:InChIKey=MVAAOKRMPXRIJL-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C=C(Br)C=C1)C2=C(C(O)=O)C=C(Br)C=C2
Synonyms:
  • Benzoic acid, 2,2′-oxybis[5-bromo-
  • 2,2′-Oxybis[5-bromobenzoic acid]
  • 5-Bromo-2-(4-bromo-2-carboxyphenoxy)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.