CAS 1311197-86-0
:6-Bromo-3-cyclopropyl-1-methyl-1H-indazole
Description:
6-Bromo-3-cyclopropyl-1-methyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of a bromine atom at the 6-position and a cyclopropyl group at the 3-position contributes to its unique reactivity and potential biological activity. The methyl group at the 1-position enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry and drug development due to its structural features that may interact with biological targets. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many indazole derivatives, it may exhibit a range of biological activities, including anti-inflammatory, analgesic, or anticancer properties, although specific biological data would depend on empirical studies. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.
Formula:C11H11BrN2
InChI:InChI=1S/C11H11BrN2/c1-14-10-6-8(12)4-5-9(10)11(13-14)7-2-3-7/h4-7H,2-3H2,1H3
InChI key:InChIKey=AOHMWGQFUZQXIN-UHFFFAOYSA-N
SMILES:CN1C=2C(C(=N1)C3CC3)=CC=C(Br)C2
Synonyms:- 6-Bromo-3-cyclopropyl-1-methyl-1H-indazole
- 1H-Indazole, 6-bromo-3-cyclopropyl-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
