CymitQuimica logo

CAS 1311197-89-3

:

N-(5-Bromo-2-pyrimidinyl)-N-(methoxymethyl)methanesulfonamide

Description:
N-(5-Bromo-2-pyrimidinyl)-N-(methoxymethyl)methanesulfonamide is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a bromine atom and a methanesulfonamide functional group. This compound features a methoxymethyl group, which enhances its solubility and reactivity. The presence of the bromine atom suggests potential for electrophilic substitution reactions, while the sulfonamide group can participate in hydrogen bonding, influencing its biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, N-(5-Bromo-2-pyrimidinyl)-N-(methoxymethyl)methanesulfonamide represents a significant compound in the field of chemical research and development.
Formula:C7H10BrN3O3S
InChI:InChI=1S/C7H10BrN3O3S/c1-14-5-11(15(2,12)13)7-9-3-6(8)4-10-7/h3-4H,5H2,1-2H3
InChI key:InChIKey=MJPNUSBHYXBRPY-UHFFFAOYSA-N
SMILES:N(COC)(S(C)(=O)=O)C=1N=CC(Br)=CN1
Synonyms:
  • N-(5-Bromo-2-pyrimidinyl)-N-(methoxymethyl)methanesulfonamide
  • Methanesulfonamide, N-(5-bromo-2-pyrimidinyl)-N-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.