CymitQuimica logo

CAS 13112-65-7

:

1,1-Dibutoxypentane

Description:
1,1-Dibutoxypentane is an organic compound characterized by its structure, which features a pentane backbone with two butoxy groups attached to the first carbon atom. This compound is classified as a dialkyl ether, and its molecular formula reflects the presence of both carbon and oxygen atoms, contributing to its unique properties. Typically, 1,1-Dibutoxypentane is a colorless liquid at room temperature, exhibiting moderate volatility and a relatively low viscosity. It is generally soluble in organic solvents but has limited solubility in water due to its hydrophobic alkyl chains. The presence of the butoxy groups enhances its potential as a solvent or reagent in various chemical reactions. Additionally, this compound may exhibit characteristics such as low toxicity and flammability, necessitating appropriate handling and storage precautions. Its applications can range from use in organic synthesis to potential roles in the formulation of specialty chemicals. As with many organic compounds, safety data sheets should be consulted for detailed information regarding its handling and potential hazards.
Formula:C13H28O2
InChI:InChI=1S/C13H28O2/c1-4-7-10-13(14-11-8-5-2)15-12-9-6-3/h13H,4-12H2,1-3H3
InChI key:InChIKey=LDJYPEMHNQONGS-UHFFFAOYSA-N
SMILES:C(OCCCC)(OCCCC)CCCC
Synonyms:
  • Valeraldehyde, dibutyl acetal
  • Pentane, 1,1-dibutoxy-
  • 1,1-Dibutoxypentane
Found 3 products.