CAS 131123-56-3
:3,6-Bis(hydroxymethyl)-2-methyl-4H-pyran-4-one
Description:
3,6-Bis(hydroxymethyl)-2-methyl-4H-pyran-4-one, with the CAS number 131123-56-3, is a chemical compound belonging to the class of pyranones. This substance features a pyran ring structure, which is a six-membered ring containing one oxygen atom and five carbon atoms. The presence of two hydroxymethyl groups at the 3 and 6 positions contributes to its hydrophilicity and potential reactivity, while the methyl group at the 2 position influences its overall stability and solubility. The compound is characterized by its ability to participate in various chemical reactions, including those involving nucleophilic substitution and condensation. It may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its physical properties, such as melting point, boiling point, and solubility, can vary depending on the specific conditions and purity of the sample. Overall, 3,6-Bis(hydroxymethyl)-2-methyl-4H-pyran-4-one is a versatile compound with potential applications in various fields.
Formula:C8H10O4
InChI:InChI=1S/C8H10O4/c1-5-7(4-10)8(11)2-6(3-9)12-5/h2,9-10H,3-4H2,1H3
InChI key:InChIKey=FEEAMUNPZANTSE-UHFFFAOYSA-N
SMILES:C(O)C=1C(=O)C=C(CO)OC1C
Synonyms:- 4H-Pyran-4-one, 3,6-bis(hydroxymethyl)-2-methyl-
- 3,6-Bis(hydroxymethyl)-2-methylpyran-4-one
- Herierin III
- 3,6-Bis(hydroxymethyl)-2-methyl-4H-pyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
