CAS 1311254-43-9

(4-Nitro-1-piperidinyl)phenylmethanone

Description:

(4-Nitro-1-piperidinyl)phenylmethanone, identified by its CAS number 1311254-43-9, is a chemical compound characterized by its structural features, which include a piperidine ring substituted with a nitro group and a phenylmethanone moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the nitro group often imparts electron-withdrawing properties, influencing the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the piperidine ring can participate in various chemical transformations, making it a versatile building block in organic synthesis. The compound may also exhibit biological activity, which is common for many piperidine derivatives, potentially serving as a lead compound in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, (4-Nitro-1-piperidinyl)phenylmethanone is of interest in both synthetic organic chemistry and medicinal chemistry contexts.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1S/C12H14N2O3/c15-12(10-4-2-1-3-5-10)13-8-6-11(7-9-13)14(16)17/h1-5,11H,6-9H2

InChI key: InChIKey=PBMCPCPFSXGPLR-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(N(=O)=O)CC1)C2=CC=CC=C2

Synonyms:

• (4-Nitro-1-piperidinyl)phenylmethanone
• Methanone, (4-nitro-1-piperidinyl)phenyl-