CymitQuimica logo

CAS 1311254-48-4

:

2H-Pyran-4-methanamine, tetrahydro-2,2-dimethyl-, hydrochloride (1:1)

Description:
2H-Pyran-4-methanamine, tetrahydro-2,2-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and an amine functional group. This compound is typically a white to off-white solid in its hydrochloride salt form, indicating its stability and solubility in water due to the presence of the hydrochloride moiety. The tetrahydro-2,2-dimethyl substitution suggests that it possesses a saturated cyclic structure, contributing to its potential biological activity. As an amine, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and complexation with acids. The compound's specific applications may vary, but it could be relevant in pharmaceutical research, particularly in the development of new therapeutic agents. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use. Overall, this compound represents a class of organic molecules with potential utility in medicinal chemistry and related fields.
Formula:C8H17NO·ClH
InChI:InChI=1S/C8H17NO.ClH/c1-8(2)5-7(6-9)3-4-10-8;/h7H,3-6,9H2,1-2H3;1H
InChI key:InChIKey=UQGLGYXFPXWXQJ-UHFFFAOYSA-N
SMILES:C(N)C1CC(C)(C)OCC1.Cl
Synonyms:
  • 2H-Pyran-4-methanamine, tetrahydro-2,2-dimethyl-, hydrochloride (1:1)
Found 3 products.