CAS 1311254-49-5
:9-Hydroxy-5-methyl-6,7-diazaspiro[3.5]non-5-en-8-one
Description:
9-Hydroxy-5-methyl-6,7-diazaspiro[3.5]non-5-en-8-one, with the CAS number 1311254-49-5, is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring nitrogen atoms. This compound contains a hydroxyl group (-OH) and a methyl group (-CH3) that contribute to its reactivity and potential biological activity. The presence of the diaza moiety indicates that it has two nitrogen atoms integrated into its cyclic structure, which can influence its chemical properties, such as solubility and interaction with biological targets. The enone functional group suggests that it may participate in various chemical reactions, including nucleophilic additions and conjugate additions. Due to its structural features, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific data regarding its stability, reactivity, and biological activity would require further investigation through experimental studies.
Formula:C8H12N2O2
InChI:InChI=1S/C8H12N2O2/c1-5-8(3-2-4-8)6(11)7(12)10-9-5/h6,11H,2-4H2,1H3,(H,10,12)
InChI key:InChIKey=BHXBHAMENVSCFG-UHFFFAOYSA-N
SMILES:OC1C2(C(C)=NNC1=O)CCC2
Synonyms:- 9-Hydroxy-5-methyl-6,7-diazaspiro[3.5]non-5-en-8-one
- 6,7-Diazaspiro[3.5]non-5-en-8-one, 9-hydroxy-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.