
CAS 1311254-60-0
:6-[(2-Amino-5-methyl-4-pyridinyl)amino]-3-methyl-4(3H)-quinazolinone
Description:
6-[(2-Amino-5-methyl-4-pyridinyl)amino]-3-methyl-4(3H)-quinazolinone, identified by its CAS number 1311254-60-0, is a chemical compound that belongs to the class of quinazolinones, which are known for their diverse biological activities. This compound features a quinazolinone core structure, which is characterized by a fused benzene and pyrimidine ring system. The presence of an amino group and a methyl group on the pyridine ring contributes to its potential pharmacological properties. The compound is likely to exhibit solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting various biological pathways. Additionally, the specific arrangement of functional groups may influence its interaction with biological targets, making it a subject of interest for further research in drug discovery and development.
Formula:C15H15N5O
InChI:InChI=1S/C15H15N5O/c1-9-7-17-14(16)6-13(9)19-10-3-4-12-11(5-10)15(21)20(2)8-18-12/h3-8H,1-2H3,(H3,16,17,19)
InChI key:InChIKey=YMEAQBCMESBBFX-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(NC=3C(C)=CN=C(N)C3)C2)N=CN1C
Synonyms:- 4(3H)-Quinazolinone, 6-[(2-amino-5-methyl-4-pyridinyl)amino]-3-methyl-
- 6-[(2-Amino-5-methyl-4-pyridinyl)amino]-3-methyl-4(3H)-quinazolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.