CAS 1311254-65-5

1,1-Dimethylethyl 2-[[(5-bromo-3-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 2-[[(5-bromo-3-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1311254-65-5, is a chemical compound that features a complex structure incorporating a pyridine ring and a pyrrolidine moiety. This compound is characterized by the presence of a bromine atom, which contributes to its reactivity and potential biological activity. The dimethyl group attached to the ethyl group enhances its steric properties, influencing its interactions in chemical reactions. The carboxylate functional group suggests potential for forming salts or participating in esterification reactions. Additionally, the compound's structure indicates it may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and biological applications.

Formula: C₁₅H₂₁BrN₂O₃

InChI: InChI=1S/C15H21BrN2O3/c1-15(2,3)21-14(19)18-6-4-5-12(18)10-20-13-7-11(16)8-17-9-13/h7-9,12H,4-6,10H2,1-3H3

InChI key: InChIKey=BRXWTVYJDXBMCP-UHFFFAOYSA-N

SMILES: C(OC=1C=C(Br)C=NC1)C2N(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 1,1-Dimethylethyl 2-[[(5-bromo-3-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 2-[[(5-bromo-3-pyridinyl)oxy]methyl]-, 1,1-dimethylethyl ester