CAS 1311254-66-6

5-Bromo-2-chloro-6-(4-morpholinyl)-3-pyridinecarboxylic acid

Description:

5-Bromo-2-chloro-6-(4-morpholinyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with bromine and chlorine atoms, as well as a morpholine group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the morpholine moiety, which can enhance solubility and interaction with biological targets. The carboxylic acid functional group contributes to its acidity and potential reactivity, making it useful in various chemical reactions and applications. The presence of halogen substituents (bromine and chlorine) can influence the compound's reactivity, stability, and lipophilicity. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its structural features that can interact with biological systems. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with halogenated compounds.

Formula: C₁₀H₁₀BrClN₂O₃

InChI: InChI=1S/C10H10BrClN2O3/c11-7-5-6(10(15)16)8(12)13-9(7)14-1-3-17-4-2-14/h5H,1-4H2,(H,15,16)

InChI key: InChIKey=MYKUBDOTWZUFGB-UHFFFAOYSA-N

SMILES: BrC1=C(N=C(Cl)C(C(O)=O)=C1)N2CCOCC2

Synonyms:

• 3-Pyridinecarboxylic acid, 5-bromo-2-chloro-6-(4-morpholinyl)-
• 5-Bromo-2-chloro-6-(4-morpholinyl)-3-pyridinecarboxylic acid