
CAS 1311254-69-9
:2H-Pyran-4-methanamine, tetrahydro-4-[3-(trifluoromethyl)phenyl]-, hydrochloride (1:1)
Description:
2H-Pyran-4-methanamine, tetrahydro-4-[3-(trifluoromethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and a trifluoromethyl-substituted phenyl group. The presence of the tetrahydro moiety indicates that the compound is saturated, contributing to its stability and solubility in various solvents. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The trifluoromethyl group is known for imparting lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The compound's molecular interactions may be affected by the presence of the amine functional group, which can participate in hydrogen bonding and affect its reactivity. Overall, this compound's characteristics suggest potential applications in drug development, particularly in areas requiring compounds with specific pharmacological properties.
Formula:C13H16F3NO·ClH
InChI:InChI=1S/C13H16F3NO.ClH/c14-13(15,16)11-3-1-2-10(8-11)12(9-17)4-6-18-7-5-12;/h1-3,8H,4-7,9,17H2;1H
InChI key:InChIKey=QMJWJTDUBBNLIM-UHFFFAOYSA-N
SMILES:C(N)C1(CCOCC1)C2=CC(C(F)(F)F)=CC=C2.Cl
Synonyms:- 2H-Pyran-4-methanamine, tetrahydro-4-[3-(trifluoromethyl)phenyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.