CymitQuimica logo

CAS 1311254-71-3

:

Spiro[2H-indene-2,3′-piperidine], 1,3-dihydro-, hydrochloride (1:1)

Description:
Spiro[2H-indene-2,3′-piperidine], 1,3-dihydro-, hydrochloride (1:1), with CAS number 1311254-71-3, is a chemical compound characterized by its unique spirocyclic structure, which combines a piperidine ring with an indene moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. As a hydrochloride salt, it is often more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the spiro configuration may impart specific stereochemical properties that influence its reactivity and interaction with other molecules. Overall, this compound's structural features suggest it may have applications in drug development, particularly in areas requiring compounds with unique structural and functional properties. Further studies would be necessary to elucidate its specific biological activities and potential therapeutic uses.
Formula:C13H17N·ClH
InChI:InChI=1S/C13H17N.ClH/c1-2-5-12-9-13(8-11(12)4-1)6-3-7-14-10-13;/h1-2,4-5,14H,3,6-10H2;1H
InChI key:InChIKey=UAIQAWUNBNDJOP-UHFFFAOYSA-N
SMILES:C12(CC=3C(C1)=CC=CC3)CCCNC2.Cl
Synonyms:
  • Spiro[2H-indene-2,3′-piperidine], 1,3-dihydro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.