CAS 1311254-82-6

2-[(Cyclopropyloxy)imino]acetic acid

Description:

2-[(Cyclopropyloxy)imino]acetic acid is a chemical compound characterized by its unique structure, which includes a cyclopropyl group attached to an oxyimino functional group and an acetic acid moiety. This compound features a cyclopropyl ring, which contributes to its rigidity and may influence its reactivity and interaction with biological systems. The presence of the imino group suggests potential for tautomerism, while the acetic acid portion provides acidic properties, allowing for potential interactions in various chemical environments. The compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its CAS number, 1311254-82-6, allows for easy identification in chemical databases. Overall, the characteristics of 2-[(Cyclopropyloxy)imino]acetic acid highlight its potential utility in synthetic chemistry and drug development, although specific applications and biological activities would require further investigation.

Formula: C₅H₇NO₃

InChI: InChI=1S/C5H7NO3/c7-5(8)3-6-9-4-1-2-4/h3-4H,1-2H2,(H,7,8)

InChI key: InChIKey=SGZMHVPPXXJIGK-UHFFFAOYSA-N

SMILES: O(N=CC(O)=O)C1CC1

Synonyms:

• 2-[(Cyclopropyloxy)imino]acetic acid
• Acetic acid, 2-[(cyclopropyloxy)imino]-