CAS 1311254-84-8

6-Chloro-2-(2R)-2-pyrrolidinyl-1H-benzimidazole

Description:

6-Chloro-2-(2R)-2-pyrrolidinyl-1H-benzimidazole is a chemical compound characterized by its unique structural features, which include a benzimidazole core and a pyrrolidine substituent. The presence of a chlorine atom at the 6-position of the benzimidazole ring contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, which may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The specific stereochemistry indicated by the (2R) designation suggests that the pyrrolidine ring has a defined spatial arrangement, which can influence the compound's interactions with biological targets. As with many benzimidazole derivatives, this compound may be investigated for its potential applications in treating various diseases, including those related to the central nervous system or infectious diseases. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Further studies are often required to fully elucidate its properties and potential uses in pharmaceutical applications.

Formula: C₁₁H₁₂ClN₃

InChI: InChI=1S/C11H12ClN3/c12-7-3-4-8-10(6-7)15-11(14-8)9-2-1-5-13-9/h3-4,6,9,13H,1-2,5H2,(H,14,15)/t9-/m1/s1

InChI key: InChIKey=WTWLSXNDPSJKCT-SECBINFHSA-N

SMILES: ClC=1C=C2N=C(NC2=CC1)[C@H]3CCCN3

Synonyms:

• 6-Chloro-2-(2R)-2-pyrrolidinyl-1H-benzimidazole
• 1H-Benzimidazole, 6-chloro-2-(2R)-2-pyrrolidinyl-