CAS 1311254-95-1
:3-Pyridinemethanamine, α-ethyl-, hydrochloride (1:1), (αS)-
Description:
3-Pyridinemethanamine, α-ethyl-, hydrochloride (1:1), (αS)- is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the α-ethyl group indicates that it has an ethyl substituent on the alpha carbon relative to the amine group, which can influence its biological activity and interaction with receptors. This compound may exhibit properties typical of amines, such as being a weak base and having the ability to participate in nucleophilic reactions. Its stereochemistry, indicated by the (αS)- designation, suggests that it has a specific spatial arrangement that can affect its reactivity and interaction with biological systems. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields, where its pharmacological properties can be explored further.
Formula:C8H12N2·ClH
InChI:InChI=1S/C8H12N2.ClH/c1-2-8(9)7-4-3-5-10-6-7;/h3-6,8H,2,9H2,1H3;1H/t8-;/m0./s1
InChI key:InChIKey=DURMBIWJJACLET-QRPNPIFTSA-N
SMILES:[C@@H](CC)(N)C=1C=CC=NC1.Cl
Synonyms:- 3-Pyridinemethanamine, α-ethyl-, hydrochloride (1:1), (αS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
