
CAS 1311275-26-9
:4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde
Description:
4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a chloro substituent at the 4-position and an aldehyde functional group at the 7-position, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carboxaldehyde group suggests that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Its unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. As with many heterocycles, it may display interesting electronic properties due to the conjugation within its aromatic system. Safety data and handling precautions should be considered, as with any chemical substance, particularly when dealing with halogenated compounds.
Formula:C7H4ClN3O
InChI:InChI=1S/C7H4ClN3O/c8-7-6-5(10-3-11-7)4(2-12)1-9-6/h1-3,9H
InChI key:InChIKey=RBECIRPDHXWKLF-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=C(Cl)N=CN2)NC1
Synonyms:- 5H-Pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde, 4-chloro-
- 4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.