
CAS 1311275-29-2
:4,6-Dichloro-2-cyclopropyl-5-pyrimidineacetaldehyde
Description:
4,6-Dichloro-2-cyclopropyl-5-pyrimidineacetaldehyde is a chemical compound characterized by its pyrimidine ring structure, which is substituted with two chlorine atoms at the 4 and 6 positions, and a cyclopropyl group at the 2 position. The presence of the aldehyde functional group contributes to its reactivity, making it a potential intermediate in organic synthesis. This compound is likely to exhibit moderate to high polarity due to the electronegative chlorine atoms and the aldehyde group, influencing its solubility in various solvents. Additionally, the chlorinated pyrimidine derivatives are often of interest in medicinal chemistry, as they may possess biological activity. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety data and handling precautions should be considered, as halogenated compounds can pose environmental and health risks. Overall, 4,6-Dichloro-2-cyclopropyl-5-pyrimidineacetaldehyde represents a unique structure with potential utility in chemical research and development.
Formula:C9H8Cl2N2O
InChI:InChI=1S/C9H8Cl2N2O/c10-7-6(3-4-14)8(11)13-9(12-7)5-1-2-5/h4-5H,1-3H2
InChI key:InChIKey=RJVYGKSAALVBAX-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC(Cl)=C1CC=O)C2CC2
Synonyms:- 5-Pyrimidineacetaldehyde, 4,6-dichloro-2-cyclopropyl-
- 4,6-Dichloro-2-cyclopropyl-5-pyrimidineacetaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.