CymitQuimica logo

CAS 1311275-31-6

:

7-Bromo-4-chloro-5H-pyrrolo[3,2-d]pyrimidin-2-amine

Description:
7-Bromo-4-chloro-5H-pyrrolo[3,2-d]pyrimidin-2-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a bromine atom at the 7-position and a chlorine atom at the 4-position, contributing to its unique reactivity and potential biological activity. The presence of an amino group at the 2-position enhances its solubility in polar solvents and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in the fields of oncology and neurology, where similar compounds have shown promise. Its synthesis and characterization typically involve standard organic reactions, and it may exhibit properties such as fluorescence or specific binding affinities, depending on its substituents. As with many halogenated compounds, safety considerations regarding handling and disposal are essential due to potential toxicity and environmental impact.
Formula:C6H4BrClN4
InChI:InChI=1S/C6H4BrClN4/c7-2-1-10-4-3(2)11-6(9)12-5(4)8/h1,10H,(H2,9,11,12)
InChI key:InChIKey=BGSFYHGOAANXDC-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(N)=N1)C(Br)=CN2
Synonyms:
  • 7-Bromo-4-chloro-5H-pyrrolo[3,2-d]pyrimidin-2-amine
  • 5H-Pyrrolo[3,2-d]pyrimidin-2-amine, 7-bromo-4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.