CAS 1311275-33-8

7-Bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine

Description:

7-Bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar solvents and may display biological activity, making it of interest in drug discovery and development. Its molecular structure allows for various functionalization possibilities, which can enhance its pharmacological properties. The compound's amine group at the 4-position can participate in hydrogen bonding, influencing its interactions with biological targets. Additionally, the presence of halogens like bromine can affect the compound's lipophilicity and overall stability. As with many heterocycles, the electronic properties of 7-Bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine can be tuned for specific applications, particularly in the development of novel therapeutic agents.

Formula: C₆H₅BrN₄

InChI: InChI=1S/C6H5BrN4/c7-3-1-9-5-4(3)10-2-11-6(5)8/h1-2,9H,(H2,8,10,11)

InChI key: InChIKey=SKJNVSMBUJLYOI-UHFFFAOYSA-N

SMILES: NC1=C2C(C(Br)=CN2)=NC=N1

Synonyms:

• 5H-Pyrrolo[3,2-d]pyrimidin-4-amine, 7-bromo-
• 7-Bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine

5H-Pyrrolo[3,2-d]pyrimidin-4-amine, 7-bromo-

CAS: 1311275-33-8

Formula: C₆H₅BrN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 213.0347

Ref: IN-DA000VKG