CAS 1311275-34-9
:6-Chloro-2-cyclopropyl-5-fluoro-4-pyrimidinamine
Description:
6-Chloro-2-cyclopropyl-5-fluoro-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of a chlorine atom at the 6 position and a fluorine atom at the 5 position contributes to its unique reactivity and potential biological activity. The cyclopropyl group at the 2 position introduces strain and can influence the compound's interaction with biological targets. This compound may exhibit properties typical of pyrimidine derivatives, such as potential use in pharmaceuticals, particularly in the development of antiviral or anticancer agents. Its specific characteristics, including solubility, stability, and reactivity, would depend on the functional groups and substituents present. Additionally, the compound's CAS number, 1311275-34-9, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data in chemical databases.
Formula:C7H7ClFN3
InChI:InChI=1S/C7H7ClFN3/c8-5-4(9)6(10)12-7(11-5)3-1-2-3/h3H,1-2H2,(H2,10,11,12)
InChI key:InChIKey=YXYSFBRZZUPNNY-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC(N)=C1F)C2CC2
Synonyms:- 4-Pyrimidinamine, 6-chloro-2-cyclopropyl-5-fluoro-
- 6-Chloro-2-cyclopropyl-5-fluoro-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.