CAS 1311278-35-9

1,1-Dimethylethyl N-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,2,4-oxadiazol-3-yl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,2,4-oxadiazol-3-yl]methyl]carbamate, identified by its CAS number 1311278-35-9, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a pyridine ring substituted with a trifluoromethyl group. This compound is typically classified as a pesticide or herbicide, reflecting its potential use in agricultural applications. Its molecular structure suggests it may exhibit specific biological activity, likely targeting certain pests or weeds. The presence of the oxadiazole moiety indicates potential for unique reactivity and interaction with biological systems. Additionally, the trifluoromethyl group is known to enhance lipophilicity, which can influence the compound's absorption and distribution in organisms. Safety and environmental impact assessments are crucial for compounds like this, as they can have significant effects on non-target species and ecosystems. Overall, this compound exemplifies the intricate design often found in agrochemicals, balancing efficacy with safety considerations.

Formula: C₁₄H₁₅F₃N₄O₃

InChI: InChI=1S/C14H15F3N4O3/c1-13(2,3)23-12(22)19-7-10-20-11(24-21-10)9-5-4-8(6-18-9)14(15,16)17/h4-6H,7H2,1-3H3,(H,19,22)

InChI key: InChIKey=VPINNSABQWBIOE-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C=1N=C(ON1)C2=CC=C(C(F)(F)F)C=N2

Synonyms:

• 1,1-Dimethylethyl N-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,2,4-oxadiazol-3-yl]methyl]carbamate
• Carbamic acid, N-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,2,4-oxadiazol-3-yl]methyl]-, 1,1-dimethylethyl ester

tert-Butyl ({5-[5-(trifluoromethyl)pyridin-2-yl]-1,2,4-oxadiazol-3-yl}methyl)carbamate

CAS: 1311278-35-9

Formula: C₁₄H₁₅F₃N₄O₃

Purity: 95.0%

Molecular weight: 344.294

Ref: 10-F316516