CAS 1311279-14-7

2-Pyridinemethanamine, 6-chloro-4-(trifluoromethyl)-, hydrochloride (1:1)

Description:

2-Pyridinemethanamine, 6-chloro-4-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group and a trifluoromethyl group on the aromatic ring significantly influences its chemical reactivity and properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. This compound may exhibit biological activity due to its amine functionality, which can participate in hydrogen bonding and interact with biological targets. The trifluoromethyl group often imparts unique electronic properties, potentially affecting the compound's lipophilicity and metabolic stability. Overall, this substance is of interest in medicinal chemistry and may serve as a building block for the synthesis of more complex molecules or as a lead compound in drug discovery efforts.

Formula: C₇H₆ClF₃N₂·ClH

InChI: InChI=1S/C7H6ClF3N2.ClH/c8-6-2-4(7(9,10)11)1-5(3-12)13-6;/h1-2H,3,12H2;1H

InChI key: InChIKey=DRHBOWBARPRECC-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(CN)N=C(Cl)C1.Cl

Synonyms:

• 2-Pyridinemethanamine, 6-chloro-4-(trifluoromethyl)-, hydrochloride (1:1)