CymitQuimica logo

CAS 1311279-74-9

:

N-[[3-[2-(Dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-N-methylglycine

Description:
N-[[3-[2-(Dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-N-methylglycine, identified by its CAS number 1311279-74-9, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by a pyridine ring substituted with a dimethylamino group and a trifluoromethyl group, which contributes to its unique chemical properties. The presence of the N-methylglycine moiety indicates that it has both amino and carboxyl functional groups, making it amphoteric and capable of participating in various chemical reactions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions, due to the influence of the dimethylamino group on biological activity. Additionally, the trifluoromethyl group may enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, this compound's intricate structure and functional groups make it a subject of interest in medicinal chemistry and drug design.
Formula:C18H20F3N3O2
InChI:InChI=1S/C18H20F3N3O2/c1-23(2)17-15(8-14(9-22-17)18(19,20)21)13-6-4-5-12(7-13)10-24(3)11-16(25)26/h4-9H,10-11H2,1-3H3,(H,25,26)
InChI key:InChIKey=XBLFHNYBDKXXPP-UHFFFAOYSA-N
SMILES:N(C)(C)C1=C(C=C(C(F)(F)F)C=N1)C2=CC(CN(CC(O)=O)C)=CC=C2
Synonyms:
  • Glycine, N-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-N-methyl-
  • N-[[3-[2-(Dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-N-methylglycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.