CAS 1311313-54-8

1H-Pyrazole-4-propanoic acid, α-amino-1-methyl-, hydrochloride (1:2)

Description:

1H-Pyrazole-4-propanoic acid, α-amino-1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a propanoic acid moiety and an α-amino group, indicating it has both acidic and basic functional groups, which can influence its solubility and reactivity. The hydrochloride form suggests that it is a salt, enhancing its stability and solubility in aqueous solutions. Typically, compounds of this nature are studied for their potential biological activities, including anti-inflammatory or analgesic properties, due to the presence of the pyrazole and amino acid functionalities. The molecular interactions of this compound may involve hydrogen bonding and ionic interactions, which are critical for its biological efficacy. As with many pharmaceuticals, the specific characteristics such as melting point, solubility, and spectral data would be essential for practical applications, but these details would require empirical data for precise values.

Formula: C₇H₁₁N₃O₂.2ClH

InChI: InChI=1S/C7H11N3O2.2ClH/c1-10-4-5(3-9-10)2-6(8)7(11)12;;/h3-4,6H,2,8H2,1H3,(H,11,12);2*1H

InChI key: InChIKey=ZJWIWJBMBHSRTN-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)N)C=1C=NN(C)C1.Cl

2-Amino-3-(1-methyl-1H-pyrazol-4-yl)propanoic acid dihydrochloride

CAS: 1311313-54-8

Versatile small molecule scaffold

Formula: C₇H₁₃Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 242.1 g/mol

Ref: 3D-LCC31354