CAS 1311313-68-4

1,1-Dimethylethyl N-[1-(2-hydroxyphenyl)propyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(2-hydroxyphenyl)propyl]carbamate, identified by its CAS number 1311313-68-4, is a chemical compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The compound exhibits a complex structure due to the presence of both a dimethyl group and a hydroxyphenyl group, contributing to its potential biological activity. It may possess properties such as solubility in organic solvents and varying stability under different conditions. The presence of the hydroxyphenyl moiety suggests potential interactions with biological systems, possibly influencing its pharmacological or toxicological profiles. As with many carbamates, it may also exhibit insecticidal or herbicidal properties, making it of interest in agricultural applications. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise determination.

Formula: C₁₄H₂₁NO₃

InChI: InChI=1S/C14H21NO3/c1-5-11(10-8-6-7-9-12(10)16)15-13(17)18-14(2,3)4/h6-9,11,16H,5H2,1-4H3,(H,15,17)

InChI key: InChIKey=MSIBEWINXMLEMV-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(CC)C1=C(O)C=CC=C1

Synonyms:

• Carbamic acid, N-[1-(2-hydroxyphenyl)propyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-(2-hydroxyphenyl)propyl]carbamate

tert-Butyl N-[1-(2-hydroxyphenyl)propyl]carbamate

CAS: 1311313-68-4

Versatile small molecule scaffold

Formula: C₁₄H₂₁NO₃

Purity: Min. 95%

Molecular weight: 251.32 g/mol

Ref: 3D-LCC31368