
CAS 1311313-79-7
:Pyridine, 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)
Description:
Pyridine, 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a chloromethyl group and a 1,2,4-oxadiazole moiety, contributing to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and agrochemicals. The presence of the oxadiazole ring suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. The chloromethyl group may serve as a reactive site for further chemical modifications. Overall, this compound's unique structural features and functional groups make it a subject of interest in synthetic organic chemistry and drug development. Safety data and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds and nitrogen-containing heterocycles.
Formula:C8H6ClN3O·ClH
InChI:InChI=1S/C8H6ClN3O.ClH/c9-5-7-11-8(12-13-7)6-1-3-10-4-2-6;/h1-4H,5H2;1H
InChI key:InChIKey=XWCUNINWPKDFRJ-UHFFFAOYSA-N
SMILES:C(Cl)C1=NC(=NO1)C=2C=CN=CC2.Cl
Synonyms:- Pyridine, 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.