CAS 1311313-83-3

1H-Pyrazole-4-carboxylic acid, 1-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:1)

Description:

1H-Pyrazole-4-carboxylic acid, 1-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a morpholine moiety, which enhances its solubility and biological activity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, improving its stability and solubility in aqueous solutions. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or analgesic effects. The presence of the morpholine group may also suggest interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, its physical properties, such as melting point and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and usage guidelines.

Formula: C₁₀H₁₅N₃O₃·ClH

InChI: InChI=1S/C10H15N3O3.ClH/c14-10(15)9-7-11-13(8-9)2-1-12-3-5-16-6-4-12;/h7-8H,1-6H2,(H,14,15);1H

InChI key: InChIKey=WTTYXDIQIGDUDI-UHFFFAOYSA-N

SMILES: C(CN1CCOCC1)N2C=C(C(O)=O)C=N2.Cl

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 1-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:1)

1-[2-(Morpholin-4-yl)ethyl]-1H-pyrazole-4-carboxylic acid hydrochloride

CAS: 1311313-83-3

Versatile small molecule scaffold

Formula: C₁₀H₁₆ClN₃O₃

Purity: Min. 95%

Molecular weight: 261.7 g/mol

Ref: 3D-LCC31383