CAS 1311313-87-7
:3-Furanol, 4-aminotetrahydro-, hydrochloride (1:1)
Description:
3-Furanol, 4-aminotetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a tetrahydrofuran moiety, indicating it is a saturated derivative of furan, and includes an amino group, which contributes to its basicity and potential reactivity. The hydrochloride designation indicates that the compound is in its salt form, typically enhancing its solubility in water and stability. This substance may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other substances. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Further studies and analyses are often required to fully understand its behavior and applications in various fields, including medicinal chemistry and materials science.
Formula:C4H9NO2·ClH
InChI:InChI=1S/C4H9NO2.ClH/c5-3-1-7-2-4(3)6;/h3-4,6H,1-2,5H2;1H
InChI key:InChIKey=XFDDJSOAVIFVIH-UHFFFAOYSA-N
SMILES:NC1C(O)COC1.Cl
Synonyms:- 3-Furanol, 4-aminotetrahydro-, hydrochloride (1:1)
- 3-Aminotetrahydrofuran-4-ol hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
