CAS 1311313-88-8

Benzeneacetic acid, 3,4-dichloro-α-[[2-(dimethylamino)ethyl]amino]-, hydrochloride (1:2)

Description:

Benzeneacetic acid, 3,4-dichloro-α-[[2-(dimethylamino)ethyl]amino]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with dichloro groups and an aminoethyl side chain. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and research. The presence of the dimethylamino group suggests potential biological activity, as such groups are often associated with interactions in biological systems. The dichloro substitutions may influence the compound's reactivity and stability, as halogenated compounds often exhibit unique chemical properties. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Overall, this compound's characteristics make it of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with some chlorinated compounds.

Formula: C₁₂H₁₆Cl₂N₂O₂·2ClH

InChI: InChI=1S/C12H16Cl2N2O2.2ClH/c1-16(2)6-5-15-11(12(17)18)8-3-4-9(13)10(14)7-8;;/h3-4,7,11,15H,5-6H2,1-2H3,(H,17,18);2*1H

InChI key: InChIKey=DYRBIDSSSWMILA-UHFFFAOYSA-N

SMILES: C(NCCN(C)C)(C(O)=O)C1=CC(Cl)=C(Cl)C=C1.Cl

Synonyms:

• Benzeneacetic acid, 3,4-dichloro-α-[[2-(dimethylamino)ethyl]amino]-, hydrochloride (1:2)

2-(3,4-Dichlorophenyl)-2-{[2-(dimethylamino)ethyl]amino}acetic acid dihydrochloride

CAS: 1311313-88-8

Versatile small molecule scaffold

Formula: C₁₂H₁₈Cl₄N₂O₂

Purity: Min. 95%

Molecular weight: 364.1 g/mol

Ref: 3D-LCC31388