CAS 1311313-92-4

5-Benzofuranmethanamine, α-ethyl-2,3-dihydro-2,2-dimethyl-, hydrochloride (1:1)

Description:

5-Benzofuranmethanamine, α-ethyl-2,3-dihydro-2,2-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an amine functional group. This compound typically appears as a hydrochloride salt, indicating that it is a protonated form of the base amine, which enhances its solubility in water. The presence of the ethyl and dimethyl groups contributes to its steric properties and may influence its biological activity. As a member of the benzofuran class, it may exhibit interesting pharmacological properties, potentially interacting with various biological targets. The hydrochloride form is commonly used in research and pharmaceutical applications due to its stability and ease of handling. Safety data sheets and material safety information should be consulted for handling precautions, as with any chemical substance. Overall, this compound's specific characteristics, including its reactivity and potential applications, would require further investigation through empirical studies and literature reviews.

Formula: C₁₃H₁₉NO·ClH

InChI: InChI=1S/C13H19NO.ClH/c1-4-11(14)9-5-6-12-10(7-9)8-13(2,3)15-12;/h5-7,11H,4,8,14H2,1-3H3;1H

InChI key: InChIKey=JTJJPLNQBDVKLR-UHFFFAOYSA-N

SMILES: C(CC)(N)C=1C=C2C(OC(C)(C)C2)=CC1.Cl

Synonyms:

• 5-Benzofuranmethanamine, α-ethyl-2,3-dihydro-2,2-dimethyl-, hydrochloride (1:1)

1-(2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-amine hydrochloride

CAS: 1311313-92-4

Versatile small molecule scaffold

Formula: C₁₃H₂₀ClNO

Purity: Min. 95%

Molecular weight: 241.76 g/mol

Ref: 3D-LCC31392