CAS 1311314-01-8

1H-Pyrazole-1-ethanol, 3-amino-4-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-ethanol, 3-amino-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an ethanol moiety and an amino group, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the amino and hydroxyl groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. Its CAS number, 1311314-01-8, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. As with all chemical substances, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₆H₁₁N₃O·ClH

InChI: InChI=1S/C6H11N3O.ClH/c1-5-4-9(2-3-10)8-6(5)7;/h4,10H,2-3H2,1H3,(H2,7,8);1H

InChI key: InChIKey=KIGHCEJNLNBASO-UHFFFAOYSA-N

SMILES: C(CO)N1C=C(C)C(N)=N1.Cl

Synonyms:

• 1H-Pyrazole-1-ethanol, 3-amino-4-methyl-, hydrochloride (1:1)

2-(3-Amino-4-methyl-1H-pyrazol-1-yl)ethan-1-ol hydrochloride

CAS: 1311314-01-8

Versatile small molecule scaffold

Formula: C₆H₁₂ClN₃O

Purity: Min. 95%

Molecular weight: 177.63 g/mol

Ref: 3D-LCC31401