CAS 1311314-02-9

Methyl 2-[[(2,2,2-trifluoroethoxy)carbonyl]amino]benzoate

Description:

Methyl 2-[[(2,2,2-trifluoroethoxy)carbonyl]amino]benzoate, with the CAS number 1311314-02-9, is an organic compound characterized by its complex structure that includes a benzoate moiety and a trifluoroethoxy carbonyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the trifluoroethoxy group imparts unique electronic properties, enhancing its stability and influencing its interactions in various chemical environments. Methyl esters, such as this compound, are generally known for their moderate polarity, which can affect their solubility in organic solvents. Additionally, the trifluoromethyl group is known to enhance lipophilicity and can influence biological activity, making such compounds of interest in pharmaceutical and agrochemical research. Overall, Methyl 2-[[(2,2,2-trifluoroethoxy)carbonyl]amino]benzoate is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₁H₁₀F₃NO₄

InChI: InChI=1S/C11H10F3NO4/c1-18-9(16)7-4-2-3-5-8(7)15-10(17)19-6-11(12,13)14/h2-5H,6H2,1H3,(H,15,17)

InChI key: InChIKey=VKLVQQJFFGOJTJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(NC(OCC(F)(F)F)=O)C=CC=C1

Synonyms:

• Benzoic acid, 2-[[(2,2,2-trifluoroethoxy)carbonyl]amino]-, methyl ester
• Methyl 2-[[(2,2,2-trifluoroethoxy)carbonyl]amino]benzoate

Methyl 2-{[(2,2,2-trifluoroethoxy)carbonyl]amino}benzoate

CAS: 1311314-02-9

Versatile small molecule scaffold

Formula: C₁₁H₁₀F₃NO₄

Purity: Min. 95%

Molecular weight: 277.2 g/mol

Ref: 3D-LCC31402