CAS 1311314-07-4

2H-Indol-2-one, 3-amino-5-ethyl-1,3-dihydro-, hydrochloride (1:1)

Description:

2H-Indol-2-one, 3-amino-5-ethyl-1,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features an amino group and an ethyl substituent at the 5-position of the indole ring, contributing to its unique properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. The presence of the amino group suggests potential for biological activity, making it of interest in pharmaceutical research. Additionally, the dihydro form indicates that the compound has been partially saturated, which can influence its reactivity and interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, but specific biological activities would require further investigation through experimental studies.

Formula: C₁₀H₁₂N₂O·ClH

InChI: InChI=1S/C10H12N2O.ClH/c1-2-6-3-4-8-7(5-6)9(11)10(13)12-8;/h3-5,9H,2,11H2,1H3,(H,12,13);1H

InChI key: InChIKey=GXVLANNTHIQVSE-UHFFFAOYSA-N

SMILES: NC1C=2C(NC1=O)=CC=C(CC)C2.Cl

Synonyms:

• 2H-Indol-2-one, 3-amino-5-ethyl-1,3-dihydro-, hydrochloride (1:1)

3-amino-5-ethyl-1,3-dihydro-2H-indol-2-one hydrochloride

CAS: 1311314-07-4

Formula: C₁₀H₁₃ClN₂O

Purity: 95.0%

Molecular weight: 212.68

Ref: 10-F360581