CAS 1311314-09-6

5,6-Dimethyl-3-(1-pyrrolidinyl)-4-pyridazinecarboxamide

Description:

5,6-Dimethyl-3-(1-pyrrolidinyl)-4-pyridazinecarboxamide is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with methyl groups and a pyrrolidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the pyrrolidine group may contribute to its pharmacological properties, possibly influencing its solubility and permeability. The carboxamide functional group suggests that it may engage in hydrogen bonding, which can enhance its interactions in biological systems. Additionally, the compound's molecular structure may confer specific reactivity patterns, making it of interest in medicinal chemistry and drug development. Its CAS number, 1311314-09-6, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, this compound represents a class of substances that could have significant implications in therapeutic contexts, warranting further investigation into its properties and potential uses.

Formula: C₁₁H₁₆N₄O

InChI: InChI=1S/C11H16N4O/c1-7-8(2)13-14-11(9(7)10(12)16)15-5-3-4-6-15/h3-6H2,1-2H3,(H2,12,16)

InChI key: InChIKey=IBEOPPSHIJDGJS-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(N=NC(C)=C1C)N2CCCC2

Synonyms:

• 5,6-Dimethyl-3-(1-pyrrolidinyl)-4-pyridazinecarboxamide
• 4-Pyridazinecarboxamide, 5,6-dimethyl-3-(1-pyrrolidinyl)-

5,6-Dimethyl-3-(pyrrolidin-1-yl)pyridazine-4-carboxamide

CAS: 1311314-09-6

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₄O

Purity: Min. 95%

Molecular weight: 220.27 g/mol

Ref: 3D-LCC31409