CAS 1311314-13-2

2-Butanamine, 1-(2-fluorophenoxy)-, hydrochloride (1:1)

Description:

2-Butanamine, 1-(2-fluorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of a fluorophenoxy substituent. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound features a butyl chain, contributing to its hydrophobic characteristics, while the 2-fluorophenoxy group introduces both steric and electronic effects that can influence its biological activity. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the context of targeting specific biological pathways. Its molecular structure suggests potential interactions with biological receptors, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all amines and their derivatives, due to potential toxicity and reactivity.

Formula: C₁₀H₁₄FNO·ClH

InChI: InChI=1S/C10H14FNO.ClH/c1-2-8(12)7-13-10-6-4-3-5-9(10)11;/h3-6,8H,2,7,12H2,1H3;1H

InChI key: InChIKey=YKJIQYZATLIKCI-UHFFFAOYSA-N

SMILES: O(CC(CC)N)C1=C(F)C=CC=C1.Cl

Synonyms:

• 2-Butanamine, 1-(2-fluorophenoxy)-, hydrochloride (1:1)

1-(2-Fluorophenoxy)butan-2-amine Hydrochloride

Controlled Product

CAS: 1311314-13-2

Formula: C₁₀H₁₄FNO•HCl

Color and Shape: Neat

Molecular weight: 183.22 + 36.46

Ref: TR-F589170

1-(2-Aminobutoxy)-2-fluorobenzene hydrochloride

CAS: 1311314-13-2

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClFNO

Purity: Min. 95%

Molecular weight: 219.68 g/mol

Ref: 3D-LCC31413