CAS 1311314-29-0

Acetic acid, 2-[(1H-imidazol-2-ylmethyl)thio]-, hydrochloride (1:1)

Description:

Acetic acid, 2-[(1H-imidazol-2-ylmethyl)thio]-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring and thioether functional group, which contribute to its biological activity and potential pharmacological properties. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in biochemical research and medicinal chemistry. The presence of the acetic acid moiety suggests that it may exhibit acidic properties, while the imidazole group can participate in hydrogen bonding and coordination with metal ions, which is significant in biological systems. Its structure may allow it to interact with biological targets, potentially influencing enzyme activity or receptor binding. The compound's CAS number, 1311314-29-0, facilitates its identification in chemical databases, aiding researchers in sourcing and studying its properties. Overall, this compound's unique structural features position it as a candidate for further investigation in drug development and other chemical applications.

Formula: C₆H₈N₂O₂S·ClH

InChI: InChI=1S/C6H8N2O2S.ClH/c9-6(10)4-11-3-5-7-1-2-8-5;/h1-2H,3-4H2,(H,7,8)(H,9,10);1H

InChI key: InChIKey=VZQGBHMDZKIFCG-UHFFFAOYSA-N

SMILES: C(SCC(O)=O)C=1NC=CN1.Cl

Synonyms:

• Acetic acid, 2-[(1H-imidazol-2-ylmethyl)thio]-, hydrochloride (1:1)

2-[(1H-Imidazol-2-ylmethyl)sulfanyl]acetic acid hydrochloride

CAS: 1311314-29-0

Versatile small molecule scaffold

Formula: C₆H₉ClN₂O₂S

Purity: Min. 95%

Molecular weight: 208.67 g/mol

Ref: 3D-LCC31429