CAS 1311314-62-1

1,1-Dimethylethyl N-[2-[(hydrazinylcarbonyl)amino]ethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-[(hydrazinylcarbonyl)amino]ethyl]carbamate, identified by its CAS number 1311314-62-1, is a chemical compound characterized by its unique structural features, which include a dimethyl group and a hydrazine moiety. This compound is likely to exhibit properties typical of carbamates, such as potential biological activity and reactivity due to the presence of the hydrazine functional group. The hydrazinylcarbonyl group suggests that it may participate in various chemical reactions, including those involving nucleophilic attack or condensation reactions. Additionally, the presence of the dimethyl group may influence its steric hindrance and solubility in organic solvents. The compound's potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and biological interactions. However, detailed studies would be necessary to fully elucidate its properties, including stability, toxicity, and potential uses in various chemical processes or formulations.

Formula: C₈H₁₈N₄O₃

InChI: InChI=1S/C8H18N4O3/c1-8(2,3)15-7(14)11-5-4-10-6(13)12-9/h4-5,9H2,1-3H3,(H,11,14)(H2,10,12,13)

InChI key: InChIKey=QATKIPIGZRCTQC-UHFFFAOYSA-N

SMILES: C(NCCNC(NN)=O)(OC(C)(C)C)=O

Synonyms:

• Carbamic acid, N-[2-[(hydrazinylcarbonyl)amino]ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[2-[(hydrazinylcarbonyl)amino]ethyl]carbamate

tert-Butyl N-{2-[(hydrazinecarbonyl)amino]ethyl}carbamate

CAS: 1311314-62-1

Versatile small molecule scaffold

Formula: C₈H₁₈N₄O₃

Purity: Min. 95%

Molecular weight: 218.25 g/mol

Ref: 3D-LCC31462