CAS 1311315-01-1

Pyridine, 4-[2-(4-piperidinyl)-4-thiazolyl]-, hydrochloride (1:2)

Description:

Pyridine, 4-[2-(4-piperidinyl)-4-thiazolyl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyridine ring and a thiazole moiety linked to a piperidine group. This compound typically appears as a hydrochloride salt, indicating that it is a protonated form, which enhances its solubility in water and polar solvents. The presence of the piperidine and thiazole groups suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Pyridine derivatives are known for their aromatic properties and can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The hydrochloride form is commonly used in pharmaceutical formulations due to its stability and ease of handling. Overall, this compound's unique structural features and properties may contribute to its utility in various applications, particularly in the fields of organic synthesis and pharmacology.

Formula: C₁₃H₁₅N₃S·2ClH

InChI: InChI=1S/C13H15N3S.2ClH/c1-5-14-6-2-10(1)12-9-17-13(16-12)11-3-7-15-8-4-11;;/h1-2,5-6,9,11,15H,3-4,7-8H2;2*1H

InChI key: InChIKey=LVSRRXAFJGIWNC-UHFFFAOYSA-N

SMILES: C=1(N=C(SC1)C2CCNCC2)C=3C=CN=CC3.Cl

Synonyms:

• Pyridine, 4-[2-(4-piperidinyl)-4-thiazolyl]-, hydrochloride (1:2)

4-[2-(Piperidin-4-yl)-1,3-thiazol-4-yl]pyridine dihydrochloride

CAS: 1311315-01-1

Versatile small molecule scaffold

Formula: C₁₃H₁₇Cl₂N₃S

Purity: Min. 95%

Molecular weight: 318.3 g/mol

Ref: 3D-LCC31501