
CAS 1311315-07-7
:Piperidine, 3-(3,5-dimethyl-1H-pyrazol-1-yl)-, hydrochloride (1:2)
Description:
Piperidine, 3-(3,5-dimethyl-1H-pyrazol-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of the 3,5-dimethyl-1H-pyrazole moiety introduces additional functional properties, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as basicity due to the nitrogen atoms in both the piperidine and pyrazole rings, which can participate in hydrogen bonding and influence its reactivity. Its specific interactions and effects would depend on the context of its use, including potential roles in medicinal chemistry or as a research chemical. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C10H17N3·2ClH
InChI:InChI=1S/C10H17N3.2ClH/c1-8-6-9(2)13(12-8)10-4-3-5-11-7-10;;/h6,10-11H,3-5,7H2,1-2H3;2*1H
InChI key:InChIKey=WKVJDLBKGATBQO-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-(3,5-dimethyl-1H-pyrazol-1-yl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.