CAS 1311315-15-7

Pentanoic acid, 4-amino-4-methyl-, 1-methylpropyl ester, hydrochloride (1:1)

Description:

Pentanoic acid, 4-amino-4-methyl-, 1-methylpropyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from pentanoic acid and an amino group. The presence of the amino group indicates potential basicity and the ability to form salts, as seen in its hydrochloride form. This compound typically exhibits moderate solubility in polar solvents due to its ionic nature when in hydrochloride form, while the ester moiety may impart some hydrophobic characteristics. The structure suggests it may have applications in pharmaceuticals or as a biochemical reagent, given the presence of both an amino group and an ester. Its molecular interactions could involve hydrogen bonding due to the amino group, influencing its reactivity and solubility. As with many organic compounds, safety data should be consulted for handling and usage, particularly regarding potential toxicity or environmental impact. Further characterization would require analytical techniques such as NMR, IR spectroscopy, or mass spectrometry to confirm its structure and purity.

Formula: C₁₀H₂₁NO₂·ClH

InChI: InChI=1S/C10H21NO2.ClH/c1-5-8(2)13-9(12)6-7-10(3,4)11;/h8H,5-7,11H2,1-4H3;1H

InChI key: InChIKey=BZSHNISMRIUSBJ-UHFFFAOYSA-N

SMILES: C(CCC(C)(C)N)(OC(CC)C)=O.Cl

Synonyms:

• Pentanoic acid, 4-amino-4-methyl-, 1-methylpropyl ester, hydrochloride (1:1)
• Butan-2-yl 4-amino-4-methylpentanoate hydrochloride

Butan-2-yl 4-amino-4-methylpentanoate hydrochloride

CAS: 1311315-15-7

Versatile small molecule scaffold

Formula: C₁₀H₂₂ClNO₂

Purity: Min. 95%

Molecular weight: 223.74 g/mol

Ref: 3D-LCC31515