CAS 1311315-18-0

Butanimidamide, 4-methoxy-, hydrochloride (1:1)

Description:

Butanimidamide, 4-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a methoxy substituent on the butanimidamide backbone. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the methoxy group can influence its biological activity and interaction with other molecules. As a hydrochloride salt, it is often used in pharmaceutical formulations to improve the compound's bioavailability and ease of handling. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific applications and biological activities would depend on further research and characterization. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₅H₁₂N₂O·ClH

InChI: InChI=1S/C5H12N2O.ClH/c1-8-4-2-3-5(6)7;/h2-4H2,1H3,(H3,6,7);1H

InChI key: InChIKey=KQTODIFTSCWXRY-UHFFFAOYSA-N

SMILES: C(CCOC)C(=N)N.Cl

Synonyms:

• Butanimidamide, 4-methoxy-, hydrochloride (1:1)

4-Methoxybutanimidamide hydrochloride

CAS: 1311315-18-0

Versatile small molecule scaffold

Formula: C₅H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 152.62 g/mol

Ref: 3D-LCC31518