CAS 1311315-28-2

Piperidine, 3-(2-methyl-1H-imidazol-1-yl)-, hydrochloride (1:2)

Description:

Piperidine, 3-(2-methyl-1H-imidazol-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of the 2-methyl-1H-imidazole moiety introduces additional heteroatoms and contributes to the compound's biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit properties such as being a potential ligand in medicinal chemistry, with implications in drug design and development. Its structure suggests potential interactions with biological targets, making it of interest in the study of pharmacology and medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity. Further characterization, including spectral analysis and biological assays, would provide more detailed insights into its properties and applications.

Formula: C₉H₁₅N₃·2ClH

InChI: InChI=1S/C9H15N3.2ClH/c1-8-11-5-6-12(8)9-3-2-4-10-7-9;;/h5-6,9-10H,2-4,7H2,1H3;2*1H

InChI key: InChIKey=JNBXDCVUUYPBNF-UHFFFAOYSA-N

SMILES: CC=1N(C=CN1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(2-methyl-1H-imidazol-1-yl)-, hydrochloride (1:2)

3-(2-Methyl-1H-imidazol-1-yl)piperidine dihydrochloride

CAS: 1311315-28-2

Versatile small molecule scaffold

Formula: C₉H₁₇Cl₂N₃

Purity: Min. 95%

Molecular weight: 238.15 g/mol

Ref: 3D-LCC31528