CAS 1311315-34-0

Cyclobutanecarboxylic acid, 3-amino-3-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Cyclobutanecarboxylic acid, 3-amino-3-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. The presence of a carboxylic acid functional group contributes to its acidic properties, while the amino group introduces basic characteristics, allowing for potential interactions in biological systems. The trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit interesting biological activities due to its unique structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 1311315-34-0, allows for precise identification in chemical databases and literature. Overall, this compound's distinct functional groups and structural characteristics suggest potential utility in research and development within the fields of organic and medicinal chemistry.

Formula: C₆H₈F₃NO₂·ClH

InChI: InChI=1S/C6H8F3NO2.ClH/c7-6(8,9)5(10)1-3(2-5)4(11)12;/h3H,1-2,10H2,(H,11,12);1H

InChI key: InChIKey=LHAVJFJEPBOBLE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1(N)CC(C(O)=O)C1.Cl

Synonyms:

• Cyclobutanecarboxylic acid, 3-amino-3-(trifluoromethyl)-, hydrochloride (1:1)

3-Amino-3-(trifluoromethyl)cyclobutane-1-carboxylic acid hydrochloride

CAS: 1311315-34-0

Versatile small molecule scaffold

Formula: C₆H₉ClF₃NO₂

Purity: Min. 95%

Molecular weight: 219.59 g/mol

Ref: 3D-LCC31534