
CAS 1311315-40-8
:2-Pyrrolidinone, 1-(2-piperidinylmethyl)-, hydrochloride (1:1)
Description:
2-Pyrrolidinone, 1-(2-piperidinylmethyl)-, hydrochloride (1:1), with CAS number 1311315-40-8, is a chemical compound characterized by its structure, which includes a pyrrolidinone ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. It is often studied for its potential pharmacological properties, particularly in the fields of medicinal chemistry and drug development. The hydrochloride salt form enhances its stability and solubility, which is beneficial for biological assays and formulations. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, including effects on the central nervous system. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Proper characterization through techniques such as NMR and mass spectrometry is crucial for confirming its identity and purity in research and industrial applications.
Formula:C10H18N2O·ClH
InChI:InChI=1S/C10H18N2O.ClH/c13-10-5-3-7-12(10)8-9-4-1-2-6-11-9;/h9,11H,1-8H2;1H
InChI key:InChIKey=UKDMCWOWHFUSGH-UHFFFAOYSA-N
SMILES:C(N1C(=O)CCC1)C2CCCCN2.Cl
Synonyms:- 2-Pyrrolidinone, 1-(2-piperidinylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.