CAS 1311315-58-8

2-[(4-Methyl-1H-pyrazol-1-yl)methyl]morpholine

Description:

2-[(4-Methyl-1H-pyrazol-1-yl)methyl]morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyrazole moiety. The morpholine part contributes to its potential as a versatile building block in organic synthesis, while the pyrazole group may impart specific biological activities. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar organic solvents, which enhances its utility in various chemical reactions. The presence of both nitrogen-containing heterocycles suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may exhibit interesting properties such as moderate to high stability under standard conditions, although specific reactivity would depend on the functional groups present. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-[(4-Methyl-1H-pyrazol-1-yl)methyl]morpholine represents a valuable compound in the field of organic and medicinal chemistry.

Formula: C₉H₁₅N₃O

InChI: InChI=1S/C9H15N3O/c1-8-4-11-12(6-8)7-9-5-10-2-3-13-9/h4,6,9-10H,2-3,5,7H2,1H3

InChI key: InChIKey=HWQFITQMUYFYKG-UHFFFAOYSA-N

SMILES: C(N1N=CC(C)=C1)C2CNCCO2

Synonyms:

• Morpholine, 2-[(4-methyl-1H-pyrazol-1-yl)methyl]-
• 2-[(4-Methyl-1H-pyrazol-1-yl)methyl]morpholine

2-[(4-Methyl-1H-pyrazol-1-yl)methyl]morpholine

Controlled Product

CAS: 1311315-58-8

Versatile small molecule scaffold

Formula: C₉H₁₅N₃O

Purity: Min. 95%

Molecular weight: 181.23 g/mol

Ref: 3D-LCC31558